A7279512
Sodium 1-heptanesulfonate , Ion -pair chromatography,> 98.0%(t) , 22767-50-6
Synonym(s):
1-Heptanesulfonic acid sodium salt;Heptane-1-sulfonic acid sodium salt
CAS NO.：22767-50-6
Empirical Formula: C7H17NaO3S
Molecular Weight: 204.26
MDL number: MFCD00007543
EINECS: 245-210-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB53.60 | In Stock |
|
| 5G | RMB169.60 | In Stock |
|
| 25G | RMB552.80 | In Stock |
|
| 100G | RMB1904.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| bulk density | 391kg/m3 |
| Density | 1.017 g/cm |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: soluble0.5M at 20°C, clear, colorless |
| form | Crystalline Powder of Flakes |
| color | White |
| PH | 5.5-7.5 (100g/l, H2O, 20℃) |
| biological source | synthetic (oragnic) |
| Water Solubility | soluble |
| λmax | λ: 210 nm Amax: 0.07 λ: 220 nm Amax: 0.04 λ: 230 nm Amax: 0.03 λ: 260 nm Amax: 0.01 λ: 500 nm Amax: 0.01 |
| BRN | 3731762 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C7H16O3S.Na.H/c1-2-3-4-5-6-7-11(8,9)10;;/h2-7H2,1H3,(H,8,9,10);; |
| InChIKey | MZPSXYLCFFPGFQ-UHFFFAOYSA-N |
| SMILES | C(S(O)(=O)=O)CCCCCC.[NaH] |
| CAS DataBase Reference | 22767-50-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Heptanesulfonic acid, sodium salt (22767-50-6) |
Description and Uses
Sodium 1-heptanesulfonate may be used as an ion-pairing reagent for the determination of ethambutol in pharmaceutical dosage forms by ion-pair reversed phase liquid chromatography with UV detection.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 37/39-26-36/37-36-24/25 |
| WGK Germany | 3 |
| F | 8-10 |
| TSCA | Yes |
| HS Code | 29041000 |
