A7280112
Sodium ascorbate , Cell culture level, ≥99.0% , 134-03-2
Synonym(s):
(+)-Sodium L -ascorbate;L (+)-Ascorbic acid sodium salt;E301; Vitamine C sodium salt;Vitamin C sodium salt
CAS NO.:134-03-2
Empirical Formula: C6H7NaO6
Molecular Weight: 198.11
MDL number: MFCD00082340
EINECS: 205-126-1
| Pack Size | Price | Stock | Quantity |
| 100G | RMB88.80 | In Stock |
|
| 500G | RMB327.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220 °C (dec.)(lit.) |
| alpha | 104 º (c=1, H2O 25 ºC) |
| Boiling point: | 235 °C |
| Density | 1.66 |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 105.5 ° (C=10, H2O) |
| storage temp. | 2-8°C |
| solubility | H2O: 50 mg/mL |
| form | powder |
| color | white to slightly yellow |
| PH | 7.48(1 mM solution);7.71(10 mM solution);7.64(100 mM solution);7.62(1000 mM solution) |
| Odor | odorless |
| biological source | synthetic (organic) |
| optical activity | [α]20/D +105±2°, c = 5% in H2O |
| Water Solubility | 620 g/L (20 ºC) |
| Merck | 14,830 |
| BRN | 3767246 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChI | 1S/C6H8O6.Na/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,7-10H,1H2;/q;+1/p-1/t2-,5+;/m0./s1 |
| InChIKey | PPASLZSBLFJQEF-RXSVEWSESA-M |
| SMILES | [Na+].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] |
| LogP | -4.2 at 21.9℃ |
| CAS DataBase Reference | 134-03-2(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium ascorbate (134-03-2) |
Description and Uses
Sodium Ascorbate is an antioxidant that is the sodium form of ascorbic acid. it is soluble in water and provides a nonacidic taste. a 10% aqueous solution has a ph of 7.3–7.6. in water, it readily reacts with atmospheric oxygen and other oxidizing agents, making it valuable as an antioxidant. one part sodium ascorbate is equivalent to 1.09 parts of sodium erythorbate. see ascorbic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 68 |
| Safety Statements | 24/25 |
| WGK Germany | 1 |
| RTECS | CI7671000 |
| TSCA | TSCA listed |
| HS Code | 29362700 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 134-03-2(Hazardous Substances Data) |
| Toxicity | sce-hmn:lym 100 mmol/L MUREAV 60,321,79 |



