A7280912
Span™ 85 , Non -ion surface active agent , 26266-58-0
Synonym(s):
Sorbitan trioleate, (Z,Z,Z)-Sorbitan tri-9-octadecenoate;Sorbitane trioleate;Span 85
CAS NO.:26266-58-0
Empirical Formula: C60H108O8
Molecular Weight: 957.49
MDL number: MFCD00133820
EINECS: 247-569-3
| Pack Size | Price | Stock | Quantity |
| 250ML | RMB71.20 | In Stock |
|
| 1L | RMB207.20 | In Stock |
|
| 5L | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -23°C(lit.) |
| Density | 0.94 g/mL at 20 °C |
| vapor pressure | <1.4 hPa (20 °C) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Store below +30°C. |
| solubility | chloroform: soluble50mg/mL, clear, faintly to light yellow |
| form | Oil |
| color | Colourless to Pale Yellow |
| Water Solubility | insoluble <0.001g/L |
| Cosmetics Ingredients Functions | SURFACTANT - EMULSIFYING |
| InChIKey | ZBNRGEMZNWHCGA-PDKVEDEMSA-N |
| SMILES | [C@@H]1(OC(=O)CCCCCCC/C=C\CCCCCCCC)[C@@H](OC(=O)CCCCCCC/C=C\CCCCCCCC)CO[C@]1([H])[C@H](O)COC(=O)CCCCCCC/C=C\CCCCCCCC |&1:0,21,44,46,r| |
| LogP | 23.296 (est) |
| CAS DataBase Reference | 26266-58-0(CAS DataBase Reference) |
| EPA Substance Registry System | Sorbitan trioleate (26266-58-0) |
Description and Uses
Sorbitane Trioleate is a detergent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H320 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 38 |
| Safety Statements | 26 |
| WGK Germany | 1 |
| RTECS | WG2934550 |
| HS Code | 29161500 |
| Toxicity | LD50 orally in Rabbit: 39800 mg/kg |





