A7282912
Sodium laurylsulfonate , AR,98.0% , 2386-53-0
Synonym(s):
1-Dodecanesulfonic acid sodium salt;1-Dodecanesulfonic Acid, Sodium Salt, Monohydrate;Dodecane-1-sulfonic acid sodium salt;Sodium laurylsulfonate;Sodium Laurylsulfonate, Dodecanesulf
CAS NO.:2386-53-0
Empirical Formula: C12H25NaO3S
Molecular Weight: 272.38
MDL number: MFCD00007527
EINECS: 219-200-6
| Pack Size | Price | Stock | Quantity |
| 25g | RMB47.20 | In Stock |
|
| 50g | RMB55.20 | In Stock |
|
| 250G | RMB199.20 | In Stock |
|
| 5KG | RMB366.40 | In Stock |
|
| 1KG | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| bulk density | 330kg/m3 |
| storage temp. | no restrictions. |
| solubility | H2O: soluble25mg/mL |
| form | Powder |
| Colour Index | 45400 |
| color | White to light cream |
| PH | 5.5-7.5 (100g/l, H2O, 20℃) |
| PH Range | 5.5 - 7.5 (100 g/l, H2O, 20 °C) |
| Water Solubility | Soluble in water. |
| BRN | 3919536 |
| InChI | InChI=1S/C12H26O3S.Na/c1-2-3-4-5-6-7-8-9-10-11-12-16(13,14)15;/h2-12H2,1H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey | OJSPTTMCDYBOPN-UHFFFAOYSA-M |
| SMILES | C(CCS([O-])(=O)=O)CCCCCCCCC.[Na+] |
| CAS DataBase Reference | 2386-53-0(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium laurylsulfonate (2386-53-0) |
Description and Uses
Sodium 1-dodecanesulfonate may be used in synthesis of metal oxide-graphene nanocomposites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |




