A7283812
Silicic acid , AR , 1343-98-2
Synonym(s):
hydrated silica;metasilcic;silica acid;Silicic acid
CAS NO.:1343-98-2
Empirical Formula: H2O3Si
Molecular Weight: 78.1
MDL number: MFCD00054122
EINECS: 215-683-2
| Pack Size | Price | Stock | Quantity |
| 500G | RMB87.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 0.230 g/cm3 |
| storage temp. | Store at room temperature, keep dry and cool |
| form | powder |
| color | White |
| Odor | Odorless |
| Water Solubility | Soluble in water. |
| Merck | 13,8564 |
| Dielectric constant | 2.0(Ambient) |
| Stability: | Stable. |
| InChI | InChI=1S/H2O3Si/c1-4(2)3/h1-2H |
| InChIKey | IJKVHSBPTUYDLN-UHFFFAOYSA-N |
| SMILES | [Si](O)(O)=O |
| CAS DataBase Reference | 1343-98-2(CAS DataBase Reference) |
| EPA Substance Registry System | Silicic acid (1343-98-2) |
Description and Uses
Silicic acid hydrate is used for studying neurodegenerative diseases due to its ability to inhibit aluminum uptake. It is utilized for the manufacture catalyst and catalyst carrier. It is involved in tungsten filament production as chemical reagent and flux. Further, it is used for oil and wax decoloring.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H373 |
| Precautionary statements | P260-P314-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37 |
| Safety Statements | 22-26-36-24/25 |
| WGK Germany | 3 |
| RTECS | VV8853000 |
| TSCA | Yes |





