A7283912
Sudan red G , 95% , 1229-55-6
Synonym(s):
1-(2-Methoxyphenylazo)-2-naphthol;Oil Red 113
CAS NO.：1229-55-6
Empirical Formula: C17H14N2O2
Molecular Weight: 278.31
MDL number: MFCD00046377
EINECS: 214-968-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB44.00 | In Stock |
|
| 25G | RMB83.20 | In Stock |
|
| 100G | RMB288.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 179 °C |
| Boiling point: | 421.12°C (rough estimate) |
| Density | 1.1222 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5500 (estimate) |
| storage temp. | room temp |
| solubility | Chloroform (Slightly), Methanol (Very Slightly) |
| form | powder |
| Colour Index | 12150 |
| pka | 13.61±0.50(Predicted) |
| color | Orange to Brown |
| Water Solubility | 330ng/L at 25℃ |
| BRN | 1843558 |
| Stability: | Hygroscopic, Light sensitive |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | HAIR DYEING COLORANT |
| InChI | 1S/C17H14N2O2/c1-21-16-9-5-4-8-14(16)18-19-17-13-7-3-2-6-12(13)10-11-15(17)20/h2-11,20H,1H3/b19-18+ |
| InChIKey | ALLOLPOYFRLCCX-VHEBQXMUSA-N |
| SMILES | COc1ccccc1\N=N\c2c(O)ccc3ccccc23 |
| LogP | 7.5 |
| CAS DataBase Reference | 1229-55-6(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Naphthalenol, 1-[(2-methoxyphenyl)azo]- (1229-55-6) |
Description and Uses
Sudan dyes and para red in food. Dyes and metabolites, Environmental Testing.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H319-H317-H350 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26-S24/25-S22 |
| WGK Germany | 2 |
| RTECS | GE5844740 |
| TSCA | TSCA listed |
| HS Code | 32129000 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 1229-55-6(Hazardous Substances Data) |
