A7288812
Sodium persulfate , 99.99%metalsbasis , 7775-27-1
Synonym(s):
Sodium peroxidisulfate;Sodium peroxodisulfate;Sodium persulfate, Peroxydisulfuric acid disodium salt
CAS NO.:7775-27-1
Empirical Formula: Na2O8S2
Molecular Weight: 238.1
MDL number: MFCD00003501
EINECS: 231-892-1
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100 °C |
| Density | 2,4 g/cm3 |
| bulk density | 1150kg/m3 |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.43 |
| storage temp. | Store at +15°C to +25°C. |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| form | Solid |
| color | White to yellow |
| Specific Gravity | 2.4 |
| Odor | Odorless |
| PH Range | 2.5 - 4.0 |
| PH | 3.5-3.8 (100g/l, H2O, 20℃) |
| Water Solubility | 550 g/L (20 ºC) |
| Merck | 14,8656 |
| Exposure limits | ACGIH: TWA 0.1 mg/m3 |
| Stability: | Stability Unstable. Strong oxidizer. Contact with combustible material may cause fire. Incompatible with combustible material, strong reducing agents, strong bases, alcohols, aluminium, magnesium. Protect from moisture. |
| Cosmetics Ingredients Functions | OXIDISING |
| InChI | 1S/2Na.H2O8S2/c;;1-9(2,3)7-8-10(4,5)6/h;;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2 |
| InChIKey | CHQMHPLRPQMAMX-UHFFFAOYSA-L |
| SMILES | [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O |
| LogP | -1 at 20℃ |
| CAS DataBase Reference | 7775-27-1(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium persulfate (7775-27-1) |
| Absorption | cut-off at 309nm in H2O at 1M |
Description and Uses
Bleaching and oxidizing agent; promoter for emulsion polymerization reactions.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS03,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H272-H302-H315-H317-H334-H335 |
| Precautionary statements | P210-P220-P261-P280-P301+P312-P302+P352 |
| target organs | Respiratory system |
| Hazard Codes | O,Xn |
| Risk Statements | 8-22-42/43-36/37/38 |
| Safety Statements | 22-36/37-45-36/37/39-26-17 |
| RIDADR | UN 1505 5.1/PG 3 |
| WGK Germany | 1 |
| RTECS | SE0525000 |
| TSCA | TSCA listed |
| HS Code | 2833 40 00 |
| HazardClass | 5.1 |
| PackingGroup | III |
| Storage Class | 5.1B - Oxidizing hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Ox. Sol. 3 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Toxicity | MLD in rabbits (mg/kg): 178 i.v. (DaVal) |
| Limited Quantities | 5 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





