A7289612
Sodium 3-sulfobenzoate , 97% , 17625-03-5
Synonym(s):
3-Carboxybenzenesulfonic acid sodium salt;3-Sulfobenzoic acid sodium salt
CAS NO.:17625-03-5
Empirical Formula: C7H5O5S.Na
Molecular Weight: 224.17
MDL number: MFCD00066378
EINECS: 241-602-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB25.60 | In Stock |
|
| 25G | RMB40.00 | In Stock |
|
| 100G | RMB151.20 | In Stock |
|
| 500G | RMB581.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C (lit.) |
| Boiling point: | 365.41℃[at 101 325 Pa] |
| Density | 1.792[at 20℃] |
| vapor pressure | 0.003Pa at 60℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | water: soluble25mg/mL, clear, colorless |
| form | powder to crystal |
| color | White to Almost white |
| Odor | essentially odorless |
| Water Solubility | 100g/L at 20.5℃ |
| BRN | 5675222 |
| InChI | InChI=1S/C7H6O5S.Na/c8-7(9)5-2-1-3-6(4-5)13(10,11)12;/h1-4H,(H,8,9)(H,10,11,12);/q;+1/p-1 |
| InChIKey | KQHKITXZJDOIOD-UHFFFAOYSA-M |
| SMILES | C1(S([O-])(=O)=O)C=CC=C(C(=O)O)C=1.[Na+] |
| LogP | 0.3 at 25℃ |
| CAS DataBase Reference | 17625-03-5(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Sulfobenzoic acid monosodium salt (17625-03-5) |
Description and Uses
Sodium 3-Sulfobenzoate is used as a reagent in the synthesis of imidazolium poly(butylene terephthalate) ionomers which can exhibit long-term antimicrobial activity even after six days.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 2916.39.7900 |




