A7291212
Sulfamethazine , 99% , 57-68-1
Synonym(s):
4,6-Dimethylsulfadiazine;4-Amino-N-(4,6-dimethyl-2-pyrimidinyl)benzenesulfonamide;Sulfadimethyldiazine;Sulfadimidine;Sulfamethazine
CAS NO.:57-68-1
Empirical Formula: C12H14N4O2S
Molecular Weight: 278.33
MDL number: MFCD00006066
EINECS: 200-346-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB32.00 | In Stock |
|
| 100G | RMB45.60 | In Stock |
|
| 500G | RMB148.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 197 °C |
| Boiling point: | 294°C (rough estimate) |
| Density | 1.2997 (rough estimate) |
| refractive index | 1.6440 (estimate) |
| storage temp. | 2-8°C |
| solubility | acetone: soluble50mg/mL |
| form | Crystalline Powder |
| pka | 7.4, 2.65(at 25℃) |
| color | white to off-white |
| Water Solubility | 150mg/100mL (29 ºC) |
| Merck | 14,8905 |
| BRN | 261304 |
| Stability: | Stable, but light sensitive. Incompatible with strong oxidizing agents. |
| InChI | 1S/C12H14N4O2S/c1-8-7-9(2)15-12(14-8)16-19(17,18)11-5-3-10(13)4-6-11/h3-7H,13H2,1-2H3,(H,14,15,16) |
| InChIKey | ASWVTGNCAZCNNR-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(N)cc2)n1 |
| CAS DataBase Reference | 57-68-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Sulfamethazine(57-68-1) |
| IARC | 3 (Vol. 79) 2001 |
| EPA Substance Registry System | Sulfamethazine (57-68-1) |
Description and Uses
Sulfamethazine is an antibacterial sulfonamide. Like other sulfonamides, sulfamethazine is bacteriostatic, competitively inhibiting dihydropteroate synthase to block folate synthesis and inhibit growth and multiplication. Sulfamethazine is metabolized by cytochrome P450 isoforms and arylamine N-acetyltransferase 2 in a sex-dependent manner.
Sulfamethazine is an antibacterial.This compound is a contaminant of emerging concern (CECs).
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H362-H315-H334-H317-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P264-P280-P305+P351+P338-P337+P313P-P201-P260-P263-P264-P270-P308+P313-P261-P285-P304+P341-P342+P311-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-24/25-36-26 |
| WGK Germany | 2 |
| RTECS | WO9275000 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 57-68-1(Hazardous Substances Data) |
| Toxicity | LD50 i.p. in mice: 1.06 g/kg (Bobranski) |





