PRODUCT Properties
| Melting point: | 256-258 °C (dec.)(lit.) |
| bulk density | 300kg/m3 |
| Density | 1.5 |
| storage temp. | Storage temperature: no restrictions. |
| solubility | H2O: passes test |
| form | Solid |
| color | white to off-white |
| PH | 5.0-7.0 (25℃, 2% in solution) |
| biological source | potato |
| Water Solubility | Soluble in hot water. |
| Merck | 14,8799 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Major Application | pharma/biopharma processes |
| Cosmetics Ingredients Functions | ABSORBENT BULKING |
| Cosmetic Ingredient Review (CIR) | Starch soluble (9005-84-9) |
| InChI | 1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11+,12-/m1/s1 |
| InChIKey | GUBGYTABKSRVRQ-ASMJPISFSA-N |
| SMILES | O1[C@@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)O[C@@H]2[C@H](O[C@@H]([C@@H]([C@H]2O)O)O)CO |
| LogP | -3.410 (est) |
| EPA Substance Registry System | Amylodextrin (9005-84-9) |
Description and Uses
Starch Soluble - ACS is used in preparation of γ-Cyclodextrin.
Safety
| WGK Germany | 1 |
| RTECS | 232-686-4 |
| TSCA | TSCA listed |
| HS Code | 35051090 |
| Storage Class | 11 - Combustible Solids |



