A7299012
Sodium bisulfate monohydrate , 99.999%metalsbasis , 10034-88-5
Synonym(s):
Sodium bisulfate monohydrate;sodium bisulfate monohydrate, sodium bisulphate monohydrate;Sodium hydrogen sulfate monohydrate
CAS NO.:10034-88-5
Empirical Formula: H3NaO5S
Molecular Weight: 138.08
MDL number: MFCD00149210
EINECS: 600-069-2
| Pack Size | Price | Stock | Quantity |
| 25G | RMB78.40 | In Stock |
|
| 100G | RMB239.20 | In Stock |
|
| 500G | RMB872.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58 °C |
| bulk density | 900-970kg/m3 |
| Density | 2.103 |
| storage temp. | Store at +5°C to +30°C. |
| solubility | 1080g/l |
| form | Solid |
| Specific Gravity | 2.103 |
| color | White |
| PH | 1 (50g/l, H2O, 20℃) |
| Odor | Odorless |
| PH Range | ~1 |
| Water Solubility | 670 g/L |
| Sensitive | Moisture Sensitive |
| Decomposition | 430°C |
| Merck | 14,8586 |
| InChI | 1S/Na.H2O4S.H2O/c;1-5(2,3)4;/h;(H2,1,2,3,4);1H2/q+1;;/p-1 |
| InChIKey | JXHZRQHZVYDRGX-UHFFFAOYSA-M |
| SMILES | [Na+].[H]O[H].OS([O-])(=O)=O |
| LogP | -1.031 (est) |
| CAS DataBase Reference | 10034-88-5(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium bisulfate monohydrate (10034-88-5) |
Description and Uses
Sodium bisulfate monohydrate (Sodium hydrogen sulfate monohydrate) may be employed as a catalyst in the following studies:
- Synthesis of n-butyl acetate.
- Esterification reaction of primary and secondary alcohols with aliphatic carboxylic acids.
- Synthesis of iso-amyl acetate.
- Synthesis of herbicide, 2,4-D butylate(butyl 2,4-dichlorophenoxyacetate).
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi,C |
| Risk Statements | 41-34 |
| Safety Statements | 24-26-45-36/37/39-27-22 |
| RIDADR | UN 3260 8/PG 3 |
| WGK Germany | 1 |
| RTECS | VZ1870000 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 28331900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 |
| Toxicity | LD50 orally in Rabbit: 2490 mg/kg |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




