A7300612
L-Serine methyl ester hydrochloride , 98% , 5680-80-8
CAS NO.：5680-80-8
Empirical Formula: C4H10ClNO3
Molecular Weight: 155.58
MDL number: MFCD00063680
EINECS: 227-140-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB47.20 | In Stock |
|
| 100G | RMB143.20 | In Stock |
|
| 500G | RMB551.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163 °C (dec.)(lit.) |
| alpha | 4.5 º (c=2, methanol) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Sparingly), Methanol (Slightly), Water (Slightly) |
| pka | pK1:7.03(+1) (25°C,μ=0.1) |
| form | Crystalline Powder or Crystals |
| color | White to off-white |
| optical activity | [α]20/D +3.4°, c = 4 in methanol |
| Water Solubility | soluble |
| Sensitive | Moisture Sensitive |
| BRN | 3559591 |
| InChI | InChI=1S/C4H9NO3.ClH/c1-8-4(7)3(5)2-6;/h3,6H,2,5H2,1H3;1H/t3-;/m0./s1 |
| InChIKey | NDBQJIBNNUJNHA-DFWYDOINSA-N |
| SMILES | C(OC)(=O)[C@H](CO)N.[H]Cl |
| LogP | -1.261 (est) |
| CAS DataBase Reference | 5680-80-8(CAS DataBase Reference) |
Description and Uses
L-Serine Methyl Ester Hydrochloride (cas# 5680-80-8) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P271 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HS Code | 29225000 |
