A7309112
3-(Trimethoxysilyl)propyl methacrylate , 97%, including 100ppMBHT stabilizer , 2530-85-0
Synonym(s):
[3-(Methacryloyloxy)propyl]trimethoxysilane;Polyfix 100, Methacryloxypropyl trimethoxysilane;Silane A 174;Silane A174
CAS NO.:2530-85-0
Empirical Formula: C10H20O5Si
Molecular Weight: 248.35
MDL number: MFCD00008593
EINECS: 219-785-8
| Pack Size | Price | Stock | Quantity |
| 50ML | RMB20.00 | In Stock |
|
| 25ML | RMB24.00 | In Stock |
|
| 100ML | RMB44.00 | In Stock |
|
| 500ML | RMB150.40 | In Stock |
|
| 2.5L | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-50°C |
| Boiling point: | 190 °C(lit.) |
| Density | 1.045 g/mL at 25 °C(lit.) |
| vapor pressure | 0-12790Pa at 20-25℃ |
| refractive index | n |
| Flash point: | 198 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| Specific Gravity | 1.045 |
| color | Clear |
| Water Solubility | Miscible with water. |
| FreezingPoint | -48 |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 1952435 |
| Cosmetics Ingredients Functions | FILM FORMING |
| InChI | 1S/C10H20O5Si/c1-9(2)10(11)15-7-6-8-16(12-3,13-4)14-5/h1,6-8H2,2-5H3 |
| InChIKey | XDLMVUHYZWKMMD-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCOC(=O)C(C)=C)(OC)OC |
| LogP | -0.9-2.1 at 20-21℃ |
| CAS DataBase Reference | 2530-85-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-(Methacryloxy)propyltrimethoxysilane(2530-85-0) |
| EPA Substance Registry System | 3-(Trimethoxysilyl)propyl methacrylate (2530-85-0) |
Description and Uses
3-(Methacryloyloxy)propyltrimethoxysilane (MPS) acts as a functional comonomer, which is used to prepare polystyrene latex having silanol by emulsion polymerization. It is used in the preparation of polymers in association with other monomers like vinyl acetate, acrylic acid and methyl acrylic acid used in coating, adhesive and sealing agents, which provides excellent adhesion and durability. The composite materials made from unsaturated polyester by using MPS improve mechanical property.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P210e-P261-P280a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-37/38-22 |
| Safety Statements | 26-28-37/39 |
| RIDADR | 3082 |
| WGK Germany | 1 |
| RTECS | UC0230000 |
| F | 4.4-8-21 |
| TSCA | TSCA listed |
| HazardClass | CBL |
| HS Code | 29161290 |
| Storage Class | 10 - Combustible liquids |
| Hazardous Substances Data | 2530-85-0(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 22600uL/kg |
| Excepted Quantities | Non-Hazardous |







![N-[3-(Trimethoxysilyl)propyl]ethylenediamine](https://img.chemicalbook.com/CAS/GIF/1760-24-3.gif)