A7319212
Sodium tetraphenylboron , 99.5% , 143-66-8
Synonym(s):
Sodium tetraphenyl borate;Sodium tetraphenylboron;Tetraphenylboron sodium
CAS NO.:143-66-8
Empirical Formula: C24H20BNa
Molecular Weight: 342.22
MDL number: MFCD00011494
EINECS: 205-605-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 10g | RMB60.00 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 100G | RMB248.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C |
| bulk density | 500kg/m3 |
| storage temp. | 2-8°C |
| solubility | relatively well soluble in water.
A 0.1 M aqueous solution is generally used as reagent. |
| form | Solid |
| color | White |
| PH | 8 (50g/l, H2O, 20℃) |
| Water Solubility | SOLUBLE |
| Sensitive | Light Sensitive |
| Merck | 14,8690 |
| BRN | 3599783 |
| Stability: | Stable. Incompatible with strong acids, strong oxidizing agents. Light sensitive. |
| InChI | InChI=1S/C24H20B.Na/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;/h1-20H;/q-1;+1 |
| InChIKey | HFSRCEJMTLMDLI-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=CC=C1)(C1=CC=CC=C1)(C1=CC=CC=C1)C1C=CC=CC=1.[Na+] |
| CAS DataBase Reference | 143-66-8(CAS DataBase Reference) |
| EPA Substance Registry System | Borate(1-), tetraphenyl-, sodium (143-66-8) |
Description and Uses
Determination of potassium, ammonium, rubidium, and cesium.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37-36-24/25 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | ED3362500 |
| F | 8 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29310095 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | LD50 orally in Rabbit: 288 mg/kg |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





