Sodium oxalate , AR , 62-76-0
Synonym(s):
di-Sodium oxalate;Ethanedioic acid sodium salt;Oxalic acid disodium salt;Oxalic acid sodium salt
CAS NO.:62-76-0
Empirical Formula: C2Na2O4
Molecular Weight: 134
MDL number: MFCD00012465
EINECS: 200-550-3
| Pack Size | Price | Stock | Quantity |
| 500G | RMB57.60 | In Stock |
|
| 2.5kg | RMB231.20 | In Stock |
|
| 20×500g | RMB1359.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 250-270 °C |
| bulk density | 600kg/m3 |
| Density | 2.34 |
| storage temp. | Store at +5°C to +30°C. |
| solubility | H2O: 0.1 M at 20 °C, clear, colorless |
| form | Powder |
| color | White |
| PH | 7-8.5 (25℃, 2.5% in H2O) |
| Odor | odorless |
| Water Solubility | 37 g/L (20 ºC) |
| Sensitive | Hygroscopic |
| Merck | 14,8650 |
| BRN | 3631622 |
| Stability: | Stability Stable; hygroscopic. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | CHELATING ANTICORROSIVE |
| InChI | 1S/C2H2O4.2Na/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;2*+1/p-2 |
| InChIKey | ZNCPFRVNHGOPAG-UHFFFAOYSA-L |
| SMILES | [Na+].[Na+].[O-]C(=O)C([O-])=O |
| CAS DataBase Reference | 62-76-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Sodium oxalate(62-76-0) |
| EPA Substance Registry System | Sodium oxalate (62-76-0) |
Description and Uses
Sodium oxalate, or disodium oxalate, is the sodium salt of oxalic acid with the molecular formula Na2C2O4. It is usually a white, crystalline, odorless powder, that decomposes at 250–270 °C.
Disodium oxalate can act as a reducing agent, and it may be used as a primary standard for standardizing potassium permanganate (KMnO4) solutions.
The mineral form of sodium oxalate is natroxalate. It is only very rarely found and restricted to extremely sodic conditions of ultraalkaline pegmatites.
Sodium Oxalate illustrate the elimination of broadening due to 2nd-?order quadrupolar effects leading to a 30-?fold increase in resolution compared to magic-?angle spinningin NMR of polycrystalline.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352+P312-P362+P364 |
| Hazard Codes | Xn |
| Risk Statements | 21/22-34 |
| Safety Statements | 24/25-45-36/37/39-26-36 |
| RIDADR | 3282 |
| WGK Germany | 1 |
| RTECS | KI1750000 |
| F | 21 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29171100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral |
| Toxicity | LD50 orally in Rabbit: 375 mg/kg |





