PRODUCT Properties
| Melting point: | 173-175 °C(lit.) |
| Boiling point: | 618.8±55.0 °C(Predicted) |
| Density | 1.19±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Acetonitrile (Slightly), Dichloromethane (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | 13.45±0.50(Predicted) |
| Colour Index | 26110 |
| color | Very Dark Red |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C24H20N4O/c1-16-6-5-8-19(14-16)25-27-22-12-11-20(15-17(22)2)26-28-24-21-9-4-3-7-18(21)10-13-23(24)29/h3-15,29H,1-2H3/b27-25+,28-26+ |
| InChIKey | NHXXLZBKTKNTEF-NBHCHVEOSA-N |
| SMILES | Cc1cccc(c1)\N=N\c2ccc(cc2C)\N=N\c3c(O)ccc4ccccc34 |
| CAS DataBase Reference | 3176-79-2(CAS DataBase Reference) |
Description and Uses
Solvent Red 25 (cas# 3176-79-2) is a useful research chemical. Dyes and metabolites, Environmental Testing.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
