A7326312
(-)-Scopolamine hydrochloride , Analysis standard , 55-16-3
Synonym(s):
Hyoscine hydrochloride;Scopine tropate
CAS NO.：55-16-3
Empirical Formula: C17H22ClNO4
Molecular Weight: 339.81
MDL number: MFCD00058096
EINECS: 200-225-6
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB396.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200° |
| Flash point: | 77 °C |
| storage temp. | -20°C |
| solubility | H2O: 50 mg/mL |
| form | powder |
| color | white |
| optical activity | [α]25/D ~ 27°, c = 1 in H2O(lit.) |
| Water Solubility | H2O: 50mg/mL |
| BRN | 4168778 |
| InChI | 1S/C17H21NO4.ClH/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10;/h2-6,11-16,19H,7-9H2,1H3;1H/t11-,12-,13-,14+,15-,16+;/m1./s1 |
| InChIKey | KXPXJGYSEPEXMF-MOUKNHLCSA-N |
| SMILES | Cl.[H][C@]12C[C@H](C[C@]([H])(N1C)[C@]3([H])O[C@]23[H])OC(=O)[C@H](CO)c4ccccc4 |
| CAS DataBase Reference | 55-16-3(CAS DataBase Reference) |
Description and Uses
Antiemetic;Non-selective muscarinic antagonist
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H317-H318 |
| Precautionary statements | P260-P262-P280-P302+P352+P310-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T+ |
| Risk Statements | 26/27/28 |
| Safety Statements | 25-45-36/37-28 |
| RIDADR | UN 1544 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CY1634501 |
| F | 3-8 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Eye Dam. 1 Skin Sens. 1 |
