A7326812
Sarsasapogenin , Analysis of standard products, ≥98% , 126-19-2
CAS NO.:126-19-2
Empirical Formula: C27H44O3
Molecular Weight: 416.64
MDL number: MFCD00075412
EINECS: 204-776-3
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB236.00 | In Stock |
|
| 20MG | RMB373.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194°C |
| alpha | D25 -75°; 25546 -89° (c = 0.5 in CHCl3) |
| Boiling point: | 474.91°C (rough estimate) |
| Density | 1.0362 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMF: 2 mg/ml; DMSO: 0.2 mg/ml; Ethanol: 2 mg/ml; Ethanol:PBS (pH 7.2)(1:2): 0.3 mg/ml |
| form | A crystalline solid |
| pka | 15.14±0.70(Predicted) |
| color | White to off-white |
| optical activity | -7525 (c 0.5, CHCl3) |
| Merck | 13,8456 |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChIKey | GMBQZIIUCVWOCD-WWASVFFGSA-N |
| SMILES | C[C@H]1CC[C@@]2(OC1)O[C@H]3C[C@H]4[C@@H]5CC[C@@H]6C[C@@H](O)CC[C@]6(C)[C@H]5CC[C@]4(C)[C@H]3[C@@H]2C |
| LogP | 6.210 (est) |
| CAS DataBase Reference | 126-19-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Sarsasapogenin(126-19-2) |
Description and Uses
Smilagengenin is a steroidal saponin with antitumor activity, which is mainly used in refreshing beverages, foaming sweets, mixed wine, etc.
Sarsasapogenin has cytotoxic properties and is used to develop lead structures for cancer drugs. Sarsasapogenin is also identified to effectively lower the production of Aβ amyloids and stimulate neurite ogrowth in neuronal cell cultures.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261-P271 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2932990090 |
| Storage Class | 11 - Combustible Solids |





