A7328312
Sulfameter , Analysis standard , 651-06-9
Synonym(s):
N1-(5-Methoxypyrimidin-2-yl)sulfanilamide;5-Methoxysulfadiazine;Sulfamethoxydiazine
CAS NO.:651-06-9
Empirical Formula: C11H12N4O3S
Molecular Weight: 280.3
MDL number: MFCD00006067
EINECS: 211-480-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB358.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 214-216°C |
| Boiling point: | 539.4±56.0 °C(Predicted) |
| Density | 1.3936 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Sparingly) |
| pka | pKa 7.02 (Uncertain) |
| form | powder |
| color | white with faint yellow cast |
| Water Solubility | 0.47g/L(30 ºC) |
| Merck | 13,8999 |
| BRN | 621130 |
| InChI | 1S/C11H12N4O3S/c1-18-9-6-13-11(14-7-9)15-19(16,17)10-4-2-8(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15) |
| InChIKey | GPTONYMQFTZPKC-UHFFFAOYSA-N |
| SMILES | COc1cnc(NS(=O)(=O)c2ccc(N)cc2)nc1 |
| CAS DataBase Reference | 651-06-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Sulfameter(651-06-9) |
Description and Uses
Sulfameter is an antibacterial.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | WP0525000 |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




