A7330612
Sodium 4-aminosalicylate dihydrate , 98% , 6018-19-5
Synonym(s):
4-Amino-2-hydroxybenzoic acid sodium salt;4-Amino-salicylic acid sodium salt;Sodium 4-aminosalicylate dihydrate
CAS NO.：6018-19-5
Empirical Formula: C7H10NNaO4
Molecular Weight: 195.15
MDL number: MFCD00151044
EINECS: 682-416-8
| Pack Size | Price | Stock | Quantity |
| 10g | RMB24.80 | In Stock |
|
| 25G | RMB41.60 | In Stock |
|
| 50G | RMB76.80 | In Stock |
|
| 100G | RMB127.20 | In Stock |
|
| 250G | RMB274.40 | In Stock |
|
| 1KG | RMB887.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 250 °C |
| RTECS | VO1700000 |
| storage temp. | 2-8°C |
| solubility | 956g/l |
| form | crystalline |
| color | white |
| PH | 6.5-8.5 (20g/l, H2O, 20℃) |
| Water Solubility | soluble |
| Sensitive | Air & Light Sensitive |
| InChI | InChI=1S/C7H7NO3.Na.H2O.H/c8-4-1-2-5(7(10)11)6(9)3-4;;;/h1-3,9H,8H2,(H,10,11);;1H2; |
| InChIKey | PMTQAAFGALNIEJ-UHFFFAOYSA-N |
| SMILES | C(C1C=CC(N)=CC=1O)(=O)O.[NaH].O |
| CAS DataBase Reference | 6018-19-5(CAS DataBase Reference) |
Description and Uses
Sodium 4-Aminosalicylate is an antibiotic used to treat tuberculosis via NF-κB inhibition and free radical scavenging.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P304+P340+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29225090 |
