A7330712
5-Sulfoisophthalic acid sodium salt , 98% , 6362-79-4
Synonym(s):
5-Sodiosulfoisophthalic acid;5-Sulfoisophthalic acid monosodium salt;Monosodium 5-sulfoisophthalate;Sodium 3,5-dicarboxybenzene-1-sulfonate;Sodium 5-sulfoisophthalate
CAS NO.:6362-79-4
Empirical Formula: C8H5NaO7S
Molecular Weight: 268.18
MDL number: MFCD00007495
EINECS: 228-845-2
| Pack Size | Price | Stock | Quantity |
| 100G | RMB44.80 | In Stock |
|
| 25G | RMB47.20 | In Stock |
|
| 500G | RMB172.80 | In Stock |
|
| 2.5kg | RMB724.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 373 °C |
| Density | 1.87[at 20℃] |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.1[at 20 ℃] |
| form | solid |
| color | White to Almost white |
| Odor | Essentially odorless |
| Water Solubility | 380 g/L |
| BRN | 4170770 |
| InChI | InChI=1S/C8H6O7S.Na.H/c9-7(10)4-1-5(8(11)12)3-6(2-4)16(13,14)15;;/h1-3H,(H,9,10)(H,11,12)(H,13,14,15);; |
| InChIKey | YXTFRJVQOWZDPP-UHFFFAOYSA-M |
| SMILES | S(C1C=C(C(=O)O)C=C(C(=O)O)C=1)(O)(=O)=O.[NaH] |
| LogP | -1.7 at 23℃ |
| CAS DataBase Reference | 6362-79-4(CAS DataBase Reference) |
| EPA Substance Registry System | Monosodium 5-sulfoisophthalate (6362-79-4) |
Description and Uses
5-Sulfoisophthalic acid sodium salt is a sulfonate carboxylate ligand which can be used in a variety of applications such as catalysis, gas storage, magnetic materials, and luminescence.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 26-37/39-45-36/37/39-25-24/25 |
| WGK Germany | 2 |
| RTECS | DB6030000 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




