A7331612
(S)-(+)-3-Amino-1-Boc-piperidine , 95% , 625471-18-3
Synonym(s):
(S)-1-Boc-3-piperidinamine;tert-Butyl (S)-3-amino-1-piperidinecarboxylate
CAS NO.:625471-18-3
Empirical Formula: C10H20N2O2
Molecular Weight: 200.28
MDL number: MFCD03094718
EINECS: 613-056-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB65.60 | In Stock |
|
| 5G | RMB154.40 | In Stock |
|
| 25g | RMB448.00 | In Stock |
|
| 100g | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | -28.5 º (c=1, DMF) |
| Boiling point: | 277.3±33.0 °C(Predicted) |
| Density | 1.02 |
| refractive index | 1.4690-1.4730 |
| Flash point: | 122℃ |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Soluble in dimethylsulfoxide. |
| pka | 10.35±0.20(Predicted) |
| form | Gum or Semi-Solid |
| color | Colorless to yellow |
| optical activity | [α]/D +32.0±3°, c = 1 in DMF |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-4-5-8(11)7-12/h8H,4-7,11H2,1-3H3/t8-/m0/s1 |
| InChIKey | AKQXKEBCONUWCL-QMMMGPOBSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC[C@H](N)C1 |
| CAS DataBase Reference | 625471-18-3(CAS DataBase Reference) |
Description and Uses
(S)-(+)-3-Amino-1-Boc-piperidine is used to prepare selective noncovalent inhibitors of the bacterial cysteine protease IdeS. The product obtained by the reductive elimination reaction with ethylglyoxalte is used as a reference compound, which is used to determine the absolute configuration of the two enantiomers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| RIDADR | 2735 |
| WGK Germany | 3 |
| F | 10-34 |
| HazardClass | 8 |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![(1S,4S)-tert-Butyl2,5-diazabicyclo[2.2.2]octane-2-carboxylatehydrochloride](https://img.chemicalbook.com/CAS/GIF/944086-67-3.gif)

![(1S,4S)-tert-Butyl2,5-diazabicyclo[2.2.2]octane-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/944238-89-5.gif)
