A7333012
(1S,2S)-(-)-1,2-Diphenyl-1,2-ethanediamine , 98% , 29841-69-8
Synonym(s):
(1S,2S)-(−)-1,2-Diamino-1,2-diphenylethane
CAS NO.:29841-69-8
Empirical Formula: C14H16N2
Molecular Weight: 212.29
MDL number: MFCD00082751
EINECS: 608-420-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB90.40 | In Stock |
|
| 25G | RMB389.60 | In Stock |
|
| 100g | RMB1377.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-85 °C(lit.) |
| Boiling point: | 342.14°C (rough estimate) |
| alpha | -104 º (c=1.1, MeOH 25 ºC) |
| Density | 1.0799 (rough estimate) |
| refractive index | -103 ° (C=1, EtOH) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| pka | 9.78±0.10(Predicted) |
| form | crystal |
| color | white to pale yellow |
| optical activity | [α]20/D 102°, c = 1 in ethanol |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| BRN | 3201645 |
| InChI | 1S/C14H16N2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14H,15-16H2/t13-,14-/m0/s1 |
| InChIKey | PONXTPCRRASWKW-KBPBESRZSA-N |
| SMILES | N[C@H]([C@@H](N)c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 29841-69-8(CAS DataBase Reference) |
Description and Uses
(1S,2S)-(-)-1,2-Diphenyl-1,2-ethanediamine solvation agent, For synthesis of enantiopure ethylenediamines by chirality transfer (condensation with diketones followed by reductive cleavage), Co-catalyst in the Ru catalyzed enantioselective hydrogenation of aromatic ketones, Versatile ligand for the formation of metal complexes.1 Used in the synthesis of chiral tropocoronands which have potential utility in asymmetric catalysis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 26-36-45-36/37/39 |
| RIDADR | UN3259 |
| WGK Germany | 3 |
| F | 10-23 |
| HazardClass | 8 |
| HS Code | 29213000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




