A7333112
(1S,2S)-(+)-N-p-Tosyl-1,2-diphenylethylenediamine , 98% , 167316-27-0
CAS NO.:167316-27-0
Empirical Formula: C21H22N2O2S
Molecular Weight: 366.48
MDL number: MFCD03095684
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB39.20 | In Stock |
|
| 1G | RMB69.60 | In Stock |
|
| 5G | RMB325.60 | In Stock |
|
| 25G | RMB1103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-131 °C (lit.) |
| alpha | 61.5 º (C=1, CH2Cl2) |
| Boiling point: | 537.3±60.0 °C(Predicted) |
| Density | 1.1440 (rough estimate) |
| refractive index | 30 ° (C=1, CHCl3) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Solubility in hot Acetonitrile (almost transparency). |
| pka | 10.76±0.50(Predicted) |
| form | crystal |
| color | white |
| optical activity | [α]20/D +35°, c = 1 in chloroform |
| InChI | InChI=1S/C21H22N2O2S/c1-16-12-14-19(15-13-16)26(24,25)23-21(18-10-6-3-7-11-18)20(22)17-8-4-2-5-9-17/h2-15,20-21,23H,22H2,1H3/t20-,21-/m0/s1 |
| InChIKey | UOPFIWYXBIHPIP-SFTDATJTSA-N |
| SMILES | C1(S(N[C@@H](C2=CC=CC=C2)[C@@H](N)C2=CC=CC=C2)(=O)=O)=CC=C(C)C=C1 |
| CAS DataBase Reference | 167316-27-0(CAS DataBase Reference) |
Description and Uses
(1S,2S)-N-(p-Toluenesulfonyl)-1,2-diphenylethanediamine is used as a catalyst in the synthesis of keramamine C, a carboline alkaloid that is isolated from the Okinawan sponge Amphimedon sp. (1S,2S)-N-(p-Toluenesulfonyl)-1,2-diphenylethanediamine is also used as a catalyst in the synthesis of Tolvaptan (T536650), a selective oral vasopressin V2-receptor agonist that is used to treat hyponatremia.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




