A7336812
Sarcosine methyl ester hydrochloride , 98% , 13515-93-0
CAS NO.：13515-93-0
Empirical Formula: C4H10ClNO2
Molecular Weight: 139.58
MDL number: MFCD00038876
EINECS: 236-853-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB92.80 | In Stock |
|
| 25G | RMB343.20 | In Stock |
|
| 100G | RMB1270.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-119 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Crystals or Crystalline Powder |
| color | White to beige |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| BRN | 3677128 |
| InChI | InChI=1S/C4H9NO2.ClH/c1-5-3-4(6)7-2;/h5H,3H2,1-2H3;1H |
| InChIKey | HQZMRJBVCVYVQA-UHFFFAOYSA-N |
| SMILES | C(=O)(OC)CNC.Cl |
| CAS DataBase Reference | 13515-93-0(CAS DataBase Reference) |
| EPA Substance Registry System | Glycine, N-methyl-, methyl ester, hydrochloride (13515-93-0) |
Description and Uses
It can react with formic acid to get N-formyl-N-methyl-glycine methyl ester in the presence of HCO2Na at ambient temperature.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn,O,Xi |
| Risk Statements | 22-37/38-41-36/37/38 |
| Safety Statements | 26-39-36 |
| WGK Germany | 3 |
| F | 3 |
| TSCA | Yes |
| HS Code | 29224999 |
