A7348712
(S)-(-)-3-(Boc-amino)pyrrolidine , 98% , 122536-76-9
Synonym(s):
tert-Butyl (S)-3-pyrrolidinylcarbamate
CAS NO.:122536-76-9
Empirical Formula: C9H18N2O2
Molecular Weight: 186.25
MDL number: MFCD00143194
EINECS: 628-488-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB150.40 | In Stock |
|
| 1g | RMB215.20 | In Stock |
|
| 25G | RMB575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50 °C |
| Boiling point: | 112°C/0.25mm |
| Density | 1.04±0.1 g/cm3(Predicted) |
| refractive index | -20 ° (C=1, EtOH) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 12.37±0.20(Predicted) |
| color | White to off-white |
| optical activity | [α]/D -21.5±2.0°, c = 1 in ethanol |
| Water Solubility | Soluble in water. |
| Sensitive | Air Sensitive |
| BRN | 5377813 |
| InChI | InChI=1S/C9H18N2O2/c1-9(2,3)13-8(12)11-7-4-5-10-6-7/h7,10H,4-6H2,1-3H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | DQQJBEAXSOOCPG-ZETCQYMHSA-N |
| SMILES | C(OC(C)(C)C)(=O)N[C@H]1CCNC1 |
| CAS DataBase Reference | 122536-76-9(CAS DataBase Reference) |
Description and Uses
(S)-3-(Boc-amino)pyrrolidine can be used as a building block to prepare:
- 2,4,6-trisubstitued pyrido[3,4-d]pyrimidine derivatives as potent inhibitors against EGFR tyrosine kinase.
- Aminopyrrolidine scaffolds for asymmetric MoritaBaylis-Hillman reaction.
- N-benzyl-3-sulfonamidopyrrolidines as potent bacterial cell division inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | 3259 |
| WGK Germany | 3 |
| F | 10-23 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





