A7351712
Suberic acid monomethyl ester , 97% , 3946-32-5
Synonym(s):
Monomethyl suberate
CAS NO.：3946-32-5
Empirical Formula: C9H16O4
Molecular Weight: 188.22
MDL number: MFCD00004427
EINECS: 609-687-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB123.20 | In Stock |
|
| 25G | RMB399.20 | In Stock |
|
| 100g | RMB1213.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 17-19 °C (lit.) |
| Boiling point: | 185-186 °C/18 mmHg (lit.) |
| Density | 1.047 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 4.76±0.10(Predicted) |
| color | Colourless |
| InChI | InChI=1S/C9H16O4/c1-13-9(12)7-5-3-2-4-6-8(10)11/h2-7H2,1H3,(H,10,11) |
| InChIKey | KOVPXZDUVJGGFU-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)CCCCCCC(O)=O |
| CAS DataBase Reference | 3946-32-5 |
Description and Uses
Suberic acid monomethyl ester was used in the synthetic preparation of Prostaglandin E1 (P838600), a primary prostaglandin and a peripheral vasodilator.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29171900 |
