A7354312
(+)-Sparteine , 98% , 492-08-0
Synonym(s):
Pachycarpine
CAS NO.:492-08-0
Empirical Formula: C15H26N2
Molecular Weight: 234.38
MDL number: MFCD00869353
EINECS: 805-899-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB79.20 | In Stock |
|
| 1G | RMB221.60 | In Stock |
|
| 5G | RMB319.20 | In Stock |
|
| 25g | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 201℃ |
| Boiling point: | 174°C/8mmHg(lit.) |
| Density | 1.08 |
| refractive index | n/D1.527 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (slightly), Ethanol |
| form | liquid |
| pka | 10.08±0.20(Predicted) |
| color | Colourless to Light Yellow |
| λmax | 202nm(CH3CN)(lit.) |
| InChI | InChI=1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2/t12-,13-,14-,15+/m1/s1 |
| InChIKey | SLRCCWJSBJZJBV-TUVASFSCSA-N |
| SMILES | N12CCCC[C@@]1([H])[C@]1([H])C[C@]([H])(C2)[C@@]2([H])CCCCN2C1 |
| CAS DataBase Reference | 492-08-0 |
Description and Uses
(+)-Sparteine is a natural alkaloid acting as a ganglionic blocking agent. (+)-Sparteine competitively blocks nicotinic ACh receptor in the neurons.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| WGK Germany | WGK 3 |
| RTECS | RT0620000 |
| HS Code | 2933998090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| Toxicity | LD50 scu-mus: 90 mg/kg FATOAO 21(5),46,58 |






![2-[2-(Methylamino)benzoyl]-3,4-dihydro-β-carboline-1(2H)-one](https://img.chemicalbook.com/CAS/20150408/GIF/526-43-2.gif)
