PRODUCT Properties
| Melting point: | 128 (dec.)(lit.) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White |
| biological source | plant (Brassica nigra) |
| optical activity | [α]20/D 17±1°, c = 1% in H2O |
| Water Solubility | almost transparency |
| Merck | 14,8545 |
| Stability: | Hygroscopic |
| InChIKey | IUBVMJHASFBYGW-WBMBWNLZSA-M |
| SMILES | [K+].[H]O[H].OC[C@H]1O[C@@H](S\C(CC=C)=N\OS([O-])(=O)=O)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP | 1.049 (est) |
| CAS DataBase Reference | 3952-98-5 |
Description and Uses
Sinigrine, is a glucosinolate which is found naturally in Cruciferae including the genus Brassica. When enzymatically hydrolysed, Sinigrine yields isothiocyanates and give a pungent taste. Both Sinigrine, and isothiocyanates, have been shown to have anticancer activity as well as antifungal and antibacterial properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | LZ5778000 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |





