A7354912
Sodium 1-pentanesulfonate monohydrate , Ion to chromatography, ≥99% , 207605-40-1
Synonym(s):
1-Pentanesulfonic acid sodium salt
CAS NO.：207605-40-1
Empirical Formula: C5H11O3S.Na
Molecular Weight: 174.19
MDL number: MFCD00149548
EINECS: 688-451-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB70.40 | In Stock |
|
| 10G | RMB281.60 | In Stock |
|
| 2.5G | RMB399.20 | In Stock |
|
| 5g | RMB639.20 | In Stock |
|
| 25g | RMB811.20 | In Stock |
|
| 50G | RMB926.40 | In Stock |
|
| 100g | RMB2151.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| Colour Index | 45410 |
| form | Liquid |
| color | White |
| Odor | Odorless |
| Water Solubility | Soluble in water. |
| λmax | λ: 210 nm Amax: 0.1 λ: 220 nm Amax: 0.06 λ: 230 nm Amax: 0.04 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02 |
| BRN | 3725147 |
| InChI | InChI=1S/C5H12O3S.Na.H2O.H/c1-2-3-4-5-9(6,7)8;;;/h2-5H2,1H3,(H,6,7,8);;1H2; |
| InChIKey | KKGWFPJAURXLQF-UHFFFAOYSA-N |
| SMILES | C(CCCC)S(O)(=O)=O.[NaH].O |
| CAS DataBase Reference | 207605-40-1(CAS DataBase Reference) |
Description and Uses
Sodium 1-Pentanesulfonate Monohydrate serves as a reagent (conversion reagent) for the simple and accurate photometric determination of the content of hemoglobin in the blood.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
