A7357712
Salvianolic acid B , ≥94%(HPLC) , 121521-90-2
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB520.00 | In Stock |
|
| 25MG | RMB1784.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-110°C |
| Boiling point: | 1020.3±65.0 °C(Predicted) |
| Density | 1.637±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | H2O: ≥5mg/mL |
| form | powder |
| pka | 2.77±0.10(Predicted) |
| color | white to tan |
| optical activity | [α]/D +95 to +115°, c = 1 in methanol |
| Water Solubility | H2O: ≥5mg/mL |
| Cosmetics Ingredients Functions | SKIN PROTECTING SKIN CONDITIONING |
| InChIKey | SNKFFCBZYFGCQN-VWUOOIFGSA-N |
| SMILES | O1C2=C(O)C=CC(/C=C/C(O[C@@H](C(O)=O)CC3=CC=C(O)C(O)=C3)=O)=C2[C@H](C(O[C@@H](C(O)=O)CC2=CC=C(O)C(O)=C2)=O)[C@H]1C1=CC=C(O)C(O)=C1 |
Description and Uses
Salvianolic acid A (Sal A) and salvianolic acid B (Sal B) were isolated and purified from the crude extract of Salvia miltiorrhiza. Antioxidant activities of Sal A and Sal B were also evaluated and the ABTS results showed that Sal A and Sal B exhibited high total antioxidant activities, their EC50 values were 1.35 0.00 and 1.43 0.01 .mu.g/mL. This compound always contains a significant amount of residual solvent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P321-P362+P364-P332+P313-P337+P313-P403+P233-P405-P501 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | DF6492107 |
| HS Code | 29329990 |







