A7365512
Semagacestat (LY450139) , ≥98% , 425386-60-3
CAS NO.:425386-60-3
Empirical Formula: C19H27N3O4
Molecular Weight: 361.44
MDL number: MFCD09970409
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB511.20 | In Stock |
|
| 10MG | RMB943.20 | In Stock |
|
| 50MG | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208-212 °C |
| Boiling point: | 681.9±55.0 °C(Predicted) |
| Density | 1.22 |
| Flash point: | 366.2℃ |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Dichloromethane (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.97±0.20(Predicted) |
| color | White |
| InChIKey | PKXWXXPNHIWQHW-RCBQFDQVSA-N |
| SMILES | O=C([C@@H](NC([C@@H](O)C(C)C)=O)C)N[C@@H](C1=CC=CC=C1CCN2C)C2=O |
Description and Uses
Semagacestat is an inhibitor of the γ-secretase enzyme. γ-Secretase enzyme is pivotal in the generation of β-amyloid (Aβ), a neurotoxic endogenous peptide believed to be involved in the pathogenesis of Alzheimer''s disease (AD).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |




