A7371212
Sulfathiazole , 98% , 72-14-0
Synonym(s):
N1-(2-Thiazolyl)sulfanilamide;2-Sulfanilamidothiazole;4-Amino-N-(2-thiazolyl)benzenesulfonamide;N1-2-Thiazolylsulfanilamid;Sulfathiazol
CAS NO.:72-14-0
Empirical Formula: C9H9N3O2S2
Molecular Weight: 255.32
MDL number: MFCD00005319
EINECS: 200-771-5
| Pack Size | Price | Stock | Quantity |
| 25g | RMB65.60 | In Stock |
|
| 50G | RMB120.00 | In Stock |
|
| 250G | RMB407.20 | In Stock |
|
| 1kg | RMB863.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200-202 °C (lit.) |
| Boiling point: | 479.5±47.0 °C(Predicted) |
| Density | 1.4629 (rough estimate) |
| refractive index | 1.6560 (estimate) |
| storage temp. | 2-8°C |
| solubility | 0.5g/l |
| form | Solid |
| pka | 7.2(at 25℃) |
| color | White |
| Water Solubility | Insoluble (<0.1 g/100 mL at 21 ºC) |
| Merck | 14,8943 |
| BRN | 226178 |
| Henry's Law Constant | 1.7×108 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | clinical testing |
| InChI | 1S/C9H9N3O2S2/c10-7-1-3-8(4-2-7)16(13,14)12-9-11-5-6-15-9/h1-6H,10H2,(H,11,12) |
| InChIKey | JNMRHUJNCSQMMB-UHFFFAOYSA-N |
| SMILES | Nc1ccc(cc1)S(=O)(=O)Nc2nccs2 |
| CAS DataBase Reference | 72-14-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Sulfathiazole(72-14-0) |
| EPA Substance Registry System | Sulfathiazole (72-14-0) |
Description and Uses
Antibacterial.This compound is a contaminant of emerging concern (CECs).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H412 |
| Precautionary statements | P261-P264-P271-P273-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3249 |
| WGK Germany | 2 |
| RTECS | WP2360000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 72-14-0(Hazardous Substances Data) |





