A7376312
Secnidazole , ≥98% , 3366-95-8
Synonym(s):
1-(2-Hydroxypropyl)-2-methyl-5-nitroimidazole;1-(2-methyl-5-nitro-1H-imidazol-1-yl) propan-2-ol;SYM-1219
CAS NO.：3366-95-8
Empirical Formula: C7H11N3O3
Molecular Weight: 185.18
MDL number: MFCD00864656
EINECS: 222-134-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB38.40 | In Stock |
|
| 5G | RMB48.80 | In Stock |
|
| 25G | RMB127.20 | In Stock |
|
| 100g | RMB498.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76°C |
| Boiling point: | 396.1±22.0 °C(Predicted) |
| Density | 1.39±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Sparingly) |
| pka | 14.50±0.20(Predicted) |
| form | Solid |
| color | White to Light Yellow |
| Water Solubility | H2O: 2mg/mL, clear (warmed) |
| λmax | 319nm(H2O)(lit.) |
| Merck | 14,8419 |
| InChI | InChI=1S/C7H11N3O3/c1-5(11)4-9-6(2)8-3-7(9)10(12)13/h3,5,11H,4H2,1-2H3 |
| InChIKey | KPQZUUQMTUIKBP-UHFFFAOYSA-N |
| SMILES | C(N1C(=NC=C1N(=O)=O)C)C(O)C |
| CAS DataBase Reference | 3366-95-8(CAS DataBase Reference) |
Description and Uses
Analog of Metronidazole. Antiamebic. Antiprotozoal (Trichomonas).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| HS Code | 2933.29.2000 |
