A7377812
S3I-201 , 96% , 501919-59-1
Synonym(s):
2-Hydroxy-4-(((4-methylphenyl)sulfonyloxy)acetyl)amino)-benzoic acid, NSC 74859;2-Hydroxy-4-[[[[(4-methylphenyl)sulfonyl]oxy]acetyl]amino]-benzoic acid;NSC 74859;STAT3 Inhibitor VI, S3I-201 - CAS 501919-59-1 - Calbiochem
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB207.20 | In Stock |
|
| 10MG | RMB359.20 | In Stock |
|
| 25mg | RMB615.20 | In Stock |
|
| 50MG | RMB880.00 | In Stock |
|
| 100mg | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >185oC (dec.) |
| Boiling point: | 654.7±55.0 °C(Predicted) |
| Density | 1.507 |
| storage temp. | -20°C |
| solubility | DMSO: >10mg/mL |
| pka | 2.98±0.10(Predicted) |
| form | powder |
| color | white to beige |
| InChI | InChI=1S/C16H15NO7S/c1-10-2-5-12(6-3-10)25(22,23)24-9-15(19)17-11-4-7-13(16(20)21)14(18)8-11/h2-8,18H,9H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | HWNUSGNZBAISFM-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(NC(COS(C2=CC=C(C)C=C2)(=O)=O)=O)C=C1O |
Description and Uses
A chemical probe inhibitor of STAT3 with an IC50 of 86 μM.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |





