A7391012
(2S,4R)-4-(((9H-fluoren-9-yl)methoxy)carbonylamino)-1-(tert-butoxycarbonyl)pyrrolidine-2-carboxylic acid , 97% , 176486-63-8
Synonym(s):
(2S,4R)-N-(tert-Butoxycarbonyl)-4-N-(9-fluorenylmethoxycarbonyl)aminopyrrolidine-2-carboxylic acid
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB124.00 | In Stock |
|
| 250MG | RMB289.60 | In Stock |
|
| 1G | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 199 °C(lit.) |
| Boiling point: | 650.2±55.0 °C(Predicted) |
| Density | 1.33 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Powder |
| pka | 3.81±0.40(Predicted) |
| color | White/off-white/palebrown |
| optical activity | [α]20/D 34°, c = 1 in chloroform |
| Major Application | peptide synthesis |
| InChIKey | UPXRTVAIJMUAQR-VFNWGFHPSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C[C@H](NC(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)C[C@H]1C(O)=O |
Description and Uses
N-?Boc-?trans-?4-?N-?Fmoc-?amino-?L-?proline is used to prepare NS3-?serine protease inhibitors of hepatitis C virus.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 22 |
| Safety Statements | 36/37/38 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |







