![Sodium tetrakis[3,5-bis(trifluoromethyl)phenyl]borate](https://img.chemicalbook.com/CAS/GIF/79060-88-1.gif)
A7391512
Sodium tetrakis[3,5-bis(trifluoromethyl)phenyl]borate , ≥98.0%(HPLC) , 79060-88-1
Synonym(s):
Benzene, 1,3-bis(trifluoromethyl)-, boron complex;NaBARF;Tetrakis[3,5-bis(trifluoromethyl)phenyl]boron sodium
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB48.80 | In Stock |
|
| 1G | RMB148.80 | In Stock |
|
| 5G | RMB469.60 | In Stock |
|
| 25G | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 310℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly) |
| form | Powder |
| color | tan |
| Water Solubility | soluble |
| BRN | 5474788 |
| InChIKey | LTGMONZOZHXAHO-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC(=CC(C(F)(F)F)=C1)C(F)(F)F)(C1=CC(=CC(C(F)(F)F)=C1)C(F)(F)F)(C1=CC(=CC(C(F)(F)F)=C1)C(F)(F)F)C1C=C(C=C(C(F)(F)F)C=1)C(F)(F)F.[Na+] |
| CAS DataBase Reference | 79060-88-1 |
Description and Uses
Sodium tetrakis[3,5-bis(trifluoromethyl)phenyl]borate was used in the preparation of poly(n-butyl acrylate)- based ion-selective membranes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-22 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
