A7394612
Boc-Asp-OtBu , 97% , 34582-32-6
Synonym(s):
α-tert-Butyl-N-Boc-L -aspartate;Boc-Asp-OtBu;N-α-t.-Boc-L-aspartic acid α-t.-butyl ester
CAS NO.:34582-32-6
Empirical Formula: C13H23NO6
Molecular Weight: 289.32
MDL number: MFCD00038272
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB72.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-103C |
| Boiling point: | 429.0±40.0 °C(Predicted) |
| Density | 1.139 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 4.13±0.19(Predicted) |
| form | Powder |
| color | White |
| optical activity | [α]/D -24.5±1.5°, c = 1 in methanol |
| BRN | 4191701 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C13H23NO6/c1-12(2,3)19-10(17)8(7-9(15)16)14-11(18)20-13(4,5)6/h8H,7H2,1-6H3,(H,14,18)(H,15,16)/t8-/m0/s1 |
| InChIKey | RAUQRYTYJIYLTF-QMMMGPOBSA-N |
| SMILES | C(OC(C)(C)C)(=O)[C@H](CC(O)=O)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 34582-32-6(CAS DataBase Reference) |
Description and Uses
An aspartic acid derivative, Boc-Asp-OtBu can be used in stereoselective synthesis
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS02 |
| Signal word | Danger |
| Hazard statements | H314-H225 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P264-P280-P370+P378-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P403+P235-P405 |
| WGK Germany | 3 |
| HS Code | 2924 19 00 |
| Storage Class | 11 - Combustible Solids |








