A7394812
3-(4-Hydroxyphenyl)propionic acid N-hydroxysuccinimide ester , 90% , 34071-95-9
Synonym(s):
N-[(4-Hydroxyhydrocinnamoyl)oxy]succinimide;N-Succinimidyl 3-(4-hydroxyphenyl)propionate;Bolton-Hunter reagent precursor;Rudinger reagent;SHPP
CAS NO.:34071-95-9
Empirical Formula: C13H13NO5
Molecular Weight: 263.25
MDL number: MFCD00005515
EINECS: 251-818-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB335.20 | In Stock |
|
| 1G | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-133 °C(lit.) |
| Boiling point: | 406.49°C (rough estimate) |
| Density | 1.2705 (rough estimate) |
| refractive index | 1.5480 (estimate) |
| storage temp. | -20°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | 9.93±0.15(Predicted) |
| color | White to Light Orange |
| Water Solubility | Soluble in water. |
| BRN | 1545011 |
| Major Application | peptide synthesis |
| InChI | 1S/C13H13NO5/c15-10-4-1-9(2-5-10)3-8-13(18)19-14-11(16)6-7-12(14)17/h1-2,4-5,15H,3,6-8H2 |
| InChIKey | KYRUKRFVOACELK-UHFFFAOYSA-N |
| SMILES | Oc1ccc(CCC(=O)ON2C(=O)CCC2=O)cc1 |
Description and Uses
3-(4-Hydroxyphenyl)propionic acid?N-hydroxysuccinimide ester can be used to prepare 125I-labeled reagents, which are used in binding assay studies of proteins and peptides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2928009090 |
| Storage Class | 11 - Combustible Solids |







