A7396112
Sulfamethazine sodium salt , 99% , 1981-58-4
Synonym(s):
4-Amino-N-(4,6-dimethyl-2-pyrimidinyl)benzenesulfonamide
CAS NO.:1981-58-4
Empirical Formula: C12H15N4NaO2S
Molecular Weight: 302.33
MDL number: MFCD00068333
EINECS: 217-840-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB43.20 | In Stock |
|
| 100G | RMB135.20 | In Stock |
|
| 500G | RMB350.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >288°C (dec.) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | H2O: soluble50mg/mL |
| form | powder |
| color | white to off-white |
| Water Solubility | H2O: soluble 50mg/mL |
| Merck | 14,8915 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C12H14N4O2S.Na.H/c1-8-7-9(2)15-12(14-8)16-19(17,18)11-5-3-10(13)4-6-11;;/h3-7H,13H2,1-2H3,(H,14,15,16);; |
| InChIKey | WIVZAHIZHZEEOX-UHFFFAOYSA-N |
| SMILES | S(C1C=CC(N)=CC=1)(=O)(=O)NC1=NC(C)=CC(C)=N1.[NaH] |
| CAS DataBase Reference | 1981-58-4 |
| EPA Substance Registry System | Benzenesulfonamide, 4-amino-N-(4,6-dimethyl-2-pyrimidinyl)-, monosodium salt (1981-58-4) |
Description and Uses
Antibacterial;Inhibitor of folic acid synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | WO9300000 |
| TSCA | TSCA listed |
| HS Code | 2933.59.8000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |



