A7398812
(S)-(+)-Ketoprofen , ≥99% , 22161-81-5
Synonym(s):
(S)-(+)-3-Benzoyl-α-methylbenzeneacetic acid;(S)-2-(3-Benzoylphenyl)propionic acid
CAS NO.:22161-81-5
Empirical Formula: C16H14O3
Molecular Weight: 254.28
MDL number: MFCD00673316
EINECS: 606-944-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB111.20 | In Stock |
|
| 5G | RMB316.80 | In Stock |
|
| 25g | RMB1075.20 | In Stock |
|
| 100g | RMB3335.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-78 °C(lit.) |
| Boiling point: | 431.3±28.0 °C(Predicted) |
| Density | 1.198±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | insoluble in H2O; ≥10.6 mg/mL in DMSO; ≥20.55 mg/mL in EtOH |
| pka | 4.23±0.10(Predicted) |
| form | White solid. |
| color | White to off-white |
| optical activity | [α]22/D +49°, c = 1 in methanol |
| InChI | InChI=1/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19)/t11-/s3 |
| InChIKey | DKYWVDODHFEZIM-LBPXTSNRNA-N |
| SMILES | C1(=CC=CC([C@H](C)C(=O)O)=C1)C(=O)C1=CC=CC=C1 |&1:5,r| |
| CAS DataBase Reference | 22161-81-5(CAS DataBase Reference) |
Description and Uses
Anti-inflammatory; analgesic
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335-H400 |
| Precautionary statements | P273-P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,T |
| Risk Statements | 22-36/37/38-50/53-25 |
| Safety Statements | 26-60-61-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CY1572790 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |








