S-(5′-Adenosyl)-<SC>L</SC>-homocysteine , ≥98% , 979-92-0
Synonym(s):
5′-Deoxy-S-adenosyl-L -homocysteine;AdoHcy;S-(5′-Adenosyl)-L -homocysteine;S-(5′-Deoxyadenosine-5′)-L -homocysteine
CAS NO.:979-92-0
Empirical Formula: C14H20N6O5S
Molecular Weight: 384.41
MDL number: MFCD00037388
EINECS: 213-560-8
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB239.20 | In Stock |
|
| 25MG | RMB399.20 | In Stock |
|
| 100MG | RMB1119.20 | In Stock |
|
| 250mg | RMB2519.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 209-211 °C |
| Boiling point: | 787.5±70.0 °C(Predicted) |
| Density | 1.91±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | 1 M HCl: soluble19.60 - 20.40mg/mL, clear to slightly hazy, colorless to faintly yellow |
| form | crystalline |
| pka | 2.22±0.10(Predicted) |
| color | Off-White to Brown |
| BRN | 99188 |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | ZJUKTBDSGOFHSH-WFMPWKQPSA-N |
| SMILES | C(O)(=O)[C@H](CCSC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N)N=C2)[C@H](O)[C@@H]1O)N |
| CAS Number Unlabeled | 979-92-0 |
Description and Uses
S-
A novel biomarker for predicting susceptibility of a subject to a mental or neurodegenerative disorder.
Safety
| WGK Germany | 3 |
| F | 8-10-23 |
| HS Code | 2934990002 |
| Storage Class | 11 - Combustible Solids |




