A7411312
(<i>S</i>)-3-(Methylamino)-1-(2-thienyl)-1-propanol , >98.0%(GC) , 116539-55-0
CAS NO.:116539-55-0
Empirical Formula: C8H13NOS
Molecular Weight: 171.26
MDL number: MFCD07357308
EINECS: 601-437-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB92.00 | In Stock |
|
| 25G | RMB236.80 | In Stock |
|
| 100g | RMB781.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72.0 to 76.0 °C |
| Boiling point: | 294.3±35.0 °C(Predicted) |
| Density | 1.128±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 13.77±0.20(Predicted) |
| color | Off-White to Pink |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1/C8H13NOS/c1-9-5-4-7(10)8-3-2-6-11-8/h2-3,6-7,9-10H,4-5H2,1H3/t7-/s3 |
| InChIKey | YEJVVFOJMOHFRL-ZETCQYMHSA-N |
| SMILES | [C@H](C1SC=CC=1)(O)CCNC |&1:0,r| |
| CAS DataBase Reference | 116539-55-0 |
Description and Uses
A Duloxetine intermediate. Duloxetine EP Impurity B.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| WGK Germany | WGK 2 |
| HS Code | 2934999090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Skin Corr. 1A |





