A7415712
Sodium 2-Propylvalerate , ≥98.0% , 1069-66-5
Synonym(s):
Sodium valproate;Valproic acid sodium salt;Sodium 2-propylpentanoate;2-propylpentanoic acid sodium;2-Propylpentanoic Acid, Na
CAS NO.:1069-66-5
Empirical Formula: C8H15NaO2
Molecular Weight: 166.19
MDL number: MFCD00078604
EINECS: 213-961-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB30.40 | In Stock |
|
| 25G | RMB82.40 | In Stock |
|
| 100G | RMB272.80 | In Stock |
|
| 500g | RMB984.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C |
| Density | 1.0803 g/cm3 |
| storage temp. | 2-8°C |
| solubility | H2O: 50 mg/mL |
| form | Fine Powder |
| pka | 4.8(at 25℃) |
| color | White |
| PH | 6.0~9.0 (50g/l, 25℃) |
| Water Solubility | soluble |
| Merck | 14,9913 |
| BCS Class | 1 |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in distilled water may be stored at -20°C for up to 3 months |
| InChI | InChI=1S/C8H16O2.Na/c1-3-5-7(6-4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+1/p-1 |
| InChIKey | AEQFSUDEHCCHBT-UHFFFAOYSA-M |
| SMILES | C(C([O-])=O)(CCC)CCC.[Na+] |
| CAS DataBase Reference | 1069-66-5(CAS DataBase Reference) |
Description and Uses
Sodium Valproate (1069-66-5) is a histone deacetylase inhibitor (IC50 = 400μM).1 Demonstrates neuroprotective, anticancer, and anti-inflammatory activity.2 Inhibits Aβ production, reduced neuritic plaque formation, and improved memory deficits in Alzheimer’s mouse models.3 Improves stem cell reprogramming efficiency and enables efficient induction of pluripotency without introduction of the oncogene c-Myc.4 Clinically useful anticonvulsant.
Anticonvulsant
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H361d |
| Precautionary statements | P201-P202-P264-P270-P301+P312-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 22-61-36/38-36/37/38 |
| Safety Statements | 36/37-53-45-37/39-26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | YV7876000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Repr. 2 |
| Toxicity | LD50 orally in mice: 1700 mg/kg (Meunier) |




