PRODUCT Properties
| Melting point: | -6 °C |
| Boiling point: | 103 °C |
| Density | 1,255 g/cm3 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | liquid |
| color | White to Orange to Green |
| Water Solubility | >=10 g/100 mL at 20 ºC |
| InChI | InChI=1S/C7H5NS2.Na/c9-7-8-5-3-1-2-4-6(5)10-7;/h1-4H,(H,8,9); |
| InChIKey | KRXFTOUYGXMRRU-UHFFFAOYSA-N |
| SMILES | S=C1SC2=CC=CC=C2N1.[Na] |
| CAS DataBase Reference | 2492-26-4(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium mercaptobenzothiazole (2492-26-4) |
Description and Uses
copper corrosion inhibitor; plasticizer and photometer for acid copper plating.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335 |
| Precautionary statements | P302+P352-P321-P332+P313-P264-P280-P362-P403+P233-P261-P271-P304+P340-P312-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | 34-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 1760 |
| RTECS | DL6725000 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2934208090 |
| Hazardous Substances Data | 2492-26-4(Hazardous Substances Data) |
