A7423912
<small>L</small>-2-Thiazolidinone-4-carboxylic Acid , 97% , 19771-63-2
Synonym(s):
L-(−)-2-Oxothiazolidine-4-carboxylic acid
CAS NO.:19771-63-2
Empirical Formula: C4H5NO3S
Molecular Weight: 147.15
MDL number: MFCD00066092
EINECS: 200-154-8
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB28.00 | In Stock |
|
| 1G | RMB58.40 | In Stock |
|
| 5G | RMB177.60 | In Stock |
|
| 10g | RMB300.00 | In Stock |
|
| 25g | RMB606.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174 °C (dec.)(lit.) |
| alpha | -60 º (c=1 in H2O) |
| Density | 1.582±0.06 g/cm3(Predicted) |
| refractive index | -64 ° (C=1, H2O) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| pka | pKa (22°): 3.32 |
| form | Powder |
| color | White to Off-white |
| Water Solubility | Soluble in water |
| Merck | 13,7019 |
| BRN | 4179169 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1S/C4H5NO3S/c6-3(7)2-1-9-4(8)5-2/h2H,1H2,(H,5,8)(H,6,7)/t2-/m0/s1 |
| InChIKey | BMLMGCPTLHPWPY-REOHCLBHSA-N |
| SMILES | S1C[C@@H](C(O)=O)NC1=O |
| CAS DataBase Reference | 19771-63-2(CAS DataBase Reference) |
Description and Uses
(R)-(-)-2-Oxothiazolidine-4-carboxylic Acid or Procysteine is a precursor to glutathione (GSH) which is an important antioxidant in plants, animals and fungi.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | XJ5426650 |
| HS Code | 2934.20.8000 |
| Storage Class | 11 - Combustible Solids |





