A7426712
Sebacic Dihydrazide , >96.0%(T) , 925-83-7
CAS NO.：925-83-7
Empirical Formula: C10H22N4O2
Molecular Weight: 230.31
MDL number: MFCD00039763
EINECS: 213-126-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB130.40 | In Stock |
|
| 100g | RMB378.40 | In Stock |
|
| 500G | RMB1360.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186 °C |
| Boiling point: | 372.3°C (rough estimate) |
| Density | 1.0881 (rough estimate) |
| vapor pressure | 0-0Pa at 20-25℃ |
| refractive index | 1.5010 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Solid:crystalline |
| color | White to Almost white |
| InChI | InChI=1S/C10H22N4O2/c11-13-9(15)7-5-3-1-2-4-6-8-10(16)14-12/h1-8,11-12H2,(H,13,15)(H,14,16) |
| InChIKey | ZWLIYXJBOIDXLL-UHFFFAOYSA-N |
| SMILES | C(NN)(=O)CCCCCCCCC(NN)=O |
| LogP | -0.8 at 20℃ and pH7.3-7.4 |
| CAS DataBase Reference | 925-83-7(CAS DataBase Reference) |
| EPA Substance Registry System | Decanedioic acid, dihydrazide (925-83-7) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H302-H315-H312-H332-H319-H412 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P280-P302+P352-P312-P322-P363-P501-P264-P280-P305+P351+P338-P337+P313P-P273-P501-P261-P271-P304+P340-P312-P264-P270-P301+P312-P330-P501 |
| RTECS | VS1225000 |
| TSCA | TSCA listed |
| HS Code | 2928.00.5000 |
| HazardClass | IRRITANT |
| REACH Registrations | Active |
