Se-(Methyl)seleno-<small>L</small>-cysteine , >98.0%(HPLC)(T) , 26046-90-2
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB125.60 | In Stock |
|
| 50mg | RMB347.20 | In Stock |
|
| 100MG | RMB605.60 | In Stock |
|
| 250mg | RMB1194.40 | In Stock |
|
| 1g | RMB3679.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 177 °C(dec.) |
| Boiling point: | 314.1±37.0 °C(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Water (Slightly) |
| pka | 2.17±0.10(Predicted) |
| form | Powder |
| color | White to slightly yellow |
| InChI | InChI=1S/C4H9NO2Se/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 |
| InChIKey | XDSSPSLGNGIIHP-VKHMYHEASA-N |
| SMILES | C(O)(=O)[C@H](C[Se]C)N |
| LogP | -0.043 (est) |
Description and Uses
Se-methyl selenocysteine (MSC) is a naturally occurring selenium compoundwith favourable pharmacokinetic properties andth high peroral bioavailability in humans. MSC is synthesized by plants such as garlic, astragalus, onions and broccoli. Se-methylselenocysteine has been proven to have a chemo-preventive property, which is shown by several authors via various cell culture models and animal models. It has also been shown to have anti-carcinogenic properties by inducing cell cycle arrest and apoptotic cell death. It is considered a pro-drug because the compound per se is not toxic unless it is metabolized by the enzymes Kynurenine aminotransferase 1 (KYAT1), Kynurenine aminotransferase 3 (KYAT3) and cystathionine γ-lyase (CTH). Of these, KYAT1 plays a vital role in MSC metabolism.
2-Amino-3-methylselenyl propionic acid is an inhibitor of DMBA-induced mammary tumors.
Safety
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H331-H373-H410 |
| Precautionary statements | P501-P273-P260-P270-P271-P264-P391-P314-P301+P310+P330-P304+P340+P311-P403+P233-P405 |
| Hazard Codes | T,N |
| Risk Statements | 23/25-33-50/53 |
| Safety Statements | 20/21-28-45-60-61-28A |
| RIDADR | UN 3283 6.1/PG 2 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 29319090 |
