A7440512
2-Sulfobenzoic Anhydride , >95.0% , 81-08-3
Synonym(s):
2-Sulfobenzoic anhydride
CAS NO.:81-08-3
Empirical Formula: C7H4O4S
Molecular Weight: 184.17
MDL number: MFCD00005879
EINECS: 201-322-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB183.20 | In Stock |
|
| 100G | RMB639.20 | In Stock |
|
| 500G | RMB2879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-124 °C |
| Boiling point: | 184-186 °C18 mm Hg(lit.) |
| Density | 1.6114 (rough estimate) |
| refractive index | 1.6290 (estimate) |
| Flash point: | 184-186°C/18mm |
| storage temp. | Store below +30°C. |
| solubility | soluble in Toluene |
| form | Crystals or Crystalline Powder |
| color | White to beige |
| Sensitive | Moisture Sensitive |
| BRN | 139893 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C7H4O4S/c8-7-5-3-1-2-4-6(5)12(9,10)11-7/h1-4H |
| InChIKey | NCYNKWQXFADUOZ-UHFFFAOYSA-N |
| SMILES | S1(=O)(=O)C2=CC=CC=C2C(=O)O1 |
| CAS DataBase Reference | 81-08-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Sulfobenzoic acid cyclic anhydride(81-08-3) |
| EPA Substance Registry System | 3H-2,1-Benzoxathiol-3-one, 1,1-dioxide (81-08-3) |
Description and Uses
Polymerization inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | C |
| Risk Statements | 34-20/21/22 |
| Safety Statements | 22-24/25-45-36/37/39-26 |
| RIDADR | 2923 |
| WGK Germany | 3 |
| F | 21 |
| TSCA | TSCA listed |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |





