A7452112
Sodium 3-Nitrobenzoate , >98.0%(HPLC) , 827-95-2
Synonym(s):
3-Nitrobenzoic acid sodium salt
CAS NO.:827-95-2
Empirical Formula: C7H6NNaO4
Molecular Weight: 191.12
MDL number: MFCD00051097
EINECS: 212-578-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB63.20 | In Stock |
|
| 100g | RMB207.20 | In Stock |
|
| 250g | RMB399.20 | In Stock |
|
| 500G | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| refractive index | 1.492 |
| storage temp. | Store below +30°C. |
| solubility | 10.9g/l |
| form | crystalline |
| color | off-white to yellow |
| Water Solubility | Soluble in water. |
| BRN | 4166479 |
| InChI | InChI=1S/C7H5NO4.Na.H/c9-7(10)5-2-1-3-6(4-5)8(11)12;;/h1-4H,(H,9,10);; |
| InChIKey | WQZWULWAPBNSEY-UHFFFAOYSA-N |
| SMILES | C(C1C=CC=C(N(=O)=O)C=1)(=O)O.[NaH] |
| CAS DataBase Reference | 827-95-2(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 3-nitro-, sodium salt (827-95-2) |
Description and Uses
Sodium 3-nitrobenzoate is an important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H228-H315-H319-H335 |
| Precautionary statements | P264-P270-P301+P310a-P321-P405-P501a-P210-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38-22 |
| Safety Statements | 16-26-36-36/37-22 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29163990 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 |





